C32H34N4O6 — CID 3941511
N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 3941511) has the molecular formula C32H34N4O6 and a molecular weight of 570.65 g/mol. Its IUPAC name is N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3941511 |
| Molecular Formula | C32H34N4O6 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(OC)cc1)C(=O)C=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H34N4O6/c1-41-20-19-35(31(37)16-11-24-7-12-27(13-8-24)36(39)40)23-32(38)34(22-25-9-14-28(42-2)15-10-25)18-17-26-21-33-30-6-4-3-5-29(26)30/h3-16,21,33H,17-20,22-23H2,1-2H3 |
| InChIKey | WRXZPLCUZRRWTB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|