C33H34N4O6 — CID 4655089
N-cyclopropyl-N-[2-[(3,4-dimethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 4655089) has the molecular formula C33H34N4O6 and a molecular weight of 582.66 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-[(3,4-dimethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-cyclopropyl-N-[2-[(3,4-dimethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4655089 |
| Molecular Formula | C33H34N4O6 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | N-cyclopropyl-N-[2-[(3,4-dimethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc(CN(CCc2c[nH]c3ccccc23)C(=O)CN(C(=O)C=Cc2ccc([N+](=O)[O-])cc2)C2CC2)cc1OC |
| InChI | InChI=1S/C33H34N4O6/c1-42-30-15-9-24(19-31(30)43-2)21-35(18-17-25-20-34-29-6-4-3-5-28(25)29)33(39)22-36(26-13-14-26)32(38)16-10-23-7-11-27(12-8-23)37(40)41/h3-12,15-16,19-20,26,34H,13-14,17-18,21-22H2,1-2H3 |
| InChIKey | SFRMSRRHIABWMT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|