C32H37N5O6 — CID 4522961
N-[(3,4-dimethoxyphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[2-methylpropyl-[(4-nitrophenyl)carbamoyl]amino]acetamide (PubChem CID 4522961) has the molecular formula C32H37N5O6 and a molecular weight of 587.68 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[2-methylpropyl-[(4-nitrophenyl)carbamoyl]amino]acetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[2-methylpropyl-[(4-nitrophenyl)carbamoyl]amino]acetamide |
|---|---|
| PubChem CID | 4522961 |
| Molecular Formula | C32H37N5O6 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[2-methylpropyl-[(4-nitrophenyl)carbamoyl]amino]acetamide |
| SMILES | COc1ccc(CN(CCc2c[nH]c3ccccc23)C(=O)CN(CC(C)C)C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C32H37N5O6/c1-22(2)19-36(32(39)34-25-10-12-26(13-11-25)37(40)41)21-31(38)35(20-23-9-14-29(42-3)30(17-23)43-4)16-15-24-18-33-28-8-6-5-7-27(24)28/h5-14,17-18,22,33H,15-16,19-21H2,1-4H3,(H,34,39) |
| InChIKey | CZDQGUWPWJQFDV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 130.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|