C33H47N3O4 — CID 24717882
N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)decanamide (PubChem CID 24717882) has the molecular formula C33H47N3O4 and a molecular weight of 549.76 g/mol. Its IUPAC name is N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)decanamide.
| Compound Name | N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)decanamide |
|---|---|
| PubChem CID | 24717882 |
| Molecular Formula | C33H47N3O4 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)decanamide |
| SMILES | CCCCCCCCCC(=O)N(CCOC)CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C33H47N3O4/c1-4-5-6-7-8-9-10-15-32(37)36(22-23-39-2)26-33(38)35(25-27-16-18-29(40-3)19-17-27)21-20-28-24-34-31-14-12-11-13-30(28)31/h11-14,16-19,24,34H,4-10,15,20-23,25-26H2,1-3H3 |
| InChIKey | WQOTUQFHEWALCW-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|