C26H25FN2O3 — CID 42656999
2-fluoro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 42656999) has the molecular formula C26H25FN2O3 and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-fluoro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 2-fluoro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42656999 |
| Molecular Formula | C26H25FN2O3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-fluoro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CN(CCc2c[nH]c3ccc(OC)cc23)C(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C26H25FN2O3/c1-31-20-9-7-18(8-10-20)17-29(26(30)22-5-3-4-6-24(22)27)14-13-19-16-28-25-12-11-21(32-2)15-23(19)25/h3-12,15-16,28H,13-14,17H2,1-2H3 |
| InChIKey | MXIGYLNCRRSSJR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |