C25H30N2O3 — CID 10112019
N-[(4-ethoxyphenyl)methyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]cyclobutanecarboxamide (PubChem CID 10112019) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]cyclobutanecarboxamide.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 10112019 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]cyclobutanecarboxamide |
| SMILES | CCOc1ccc(CN(CCc2c[nH]c3ccc(OC)cc23)C(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-3-30-21-9-7-18(8-10-21)17-27(25(28)19-5-4-6-19)14-13-20-16-26-24-12-11-22(29-2)15-23(20)24/h7-12,15-16,19,26H,3-6,13-14,17H2,1-2H3 |
| InChIKey | ZERQKHHZBRCQRT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |