C35H37F3N6OS — CID 159259938
1-[(2S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-4-methylpentyl]-3-(4-methylphenyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 159259938) has the molecular formula C35H37F3N6OS and a molecular weight of 646.78 g/mol. Its IUPAC name is 1-[(2S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-4-methylpentyl]-3-(4-methylphenyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[(2S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-4-methylpentyl]-3-(4-methylphenyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 159259938 |
| Molecular Formula | C35H37F3N6OS |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | 1-[(2S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-4-methylpentyl]-3-(4-methylphenyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2ccccc2C(F)(F)F)C(N)[C@H](CC(C)C)C(=O)Cc2cncn2Cc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C35H37F3N6OS/c1-23(2)16-30(32(45)17-29-19-41-22-43(29)20-26-12-10-25(18-39)11-13-26)33(40)44(34(46)42-28-14-8-24(3)9-15-28)21-27-6-4-5-7-31(27)35(36,37)38/h4-15,19,22-23,30,33H,16-17,20-21,40H2,1-3H3,(H,42,46)/t30-,33?/m1/s1 |
| InChIKey | KWJKNNSPIDTBRF-UEACTRMWSA-N |
| XLogP | 7.09 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|