C37H41F3N6OS — CID 57308645
1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-1-[4-methylpentyl-[[2-(trifluoromethyl)phenyl]methyl]amino]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 57308645) has the molecular formula C37H41F3N6OS and a molecular weight of 674.84 g/mol. Its IUPAC name is 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-1-[4-methylpentyl-[[2-(trifluoromethyl)phenyl]methyl]amino]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-1-[4-methylpentyl-[[2-(trifluoromethyl)phenyl]methyl]amino]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 57308645 |
| Molecular Formula | C37H41F3N6OS |
| Molecular Weight | 674.84 g/mol |
| Exact Mass | 674.30 |
| IUPAC Name | 1-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-1-[4-methylpentyl-[[2-(trifluoromethyl)phenyl]methyl]amino]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)CCCN(Cc1ccccc1C(F)(F)F)N(C(=O)Cc1cncn1Cc1ccc(C#N)cc1)C(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C37H41F3N6OS/c1-26(2)8-7-19-45(24-31-9-5-6-10-34(31)37(38,39)40)46(36(48)43-32-17-15-30(16-18-32)27(3)4)35(47)20-33-22-42-25-44(33)23-29-13-11-28(21-41)12-14-29/h5-6,9-18,22,25-27H,7-8,19-20,23-24H2,1-4H3,(H,43,48) |
| InChIKey | YLQZTPIOYXKLEF-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.84 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|