C36H39F3N6OS — CID 157096408
1-[(2S,3S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-3-methylpentyl]-3-(2-phenylethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 157096408) has the molecular formula C36H39F3N6OS and a molecular weight of 660.81 g/mol. Its IUPAC name is 1-[(2S,3S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-3-methylpentyl]-3-(2-phenylethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[(2S,3S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-3-methylpentyl]-3-(2-phenylethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 157096408 |
| Molecular Formula | C36H39F3N6OS |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | 1-[(2S,3S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-3-methylpentyl]-3-(2-phenylethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | CC[C@H](C)[C@H](C(=O)Cc1cncn1Cc1ccc(C#N)cc1)C(N)N(Cc1ccccc1C(F)(F)F)C(=S)NCCc1ccccc1 |
| InChI | InChI=1S/C36H39F3N6OS/c1-3-25(2)33(32(46)19-30-21-42-24-44(30)22-28-15-13-27(20-40)14-16-28)34(41)45(23-29-11-7-8-12-31(29)36(37,38)39)35(47)43-18-17-26-9-5-4-6-10-26/h4-16,21,24-25,33-34H,3,17-19,22-23,41H2,1-2H3,(H,43,47)/t25-,33+,34?/m0/s1 |
| InChIKey | AFGKLDWMGMTNOC-PYAUANIJSA-N |
| XLogP | 6.50 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|