C34H33Cl2F3N6OS — CID 161218680
1-[(2S,3S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-3-methylpentyl]-1-[(2,3-dichlorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 161218680) has the molecular formula C34H33Cl2F3N6OS and a molecular weight of 701.65 g/mol. Its IUPAC name is 1-[(2S,3S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-3-methylpentyl]-1-[(2,3-dichlorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(2S,3S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-3-methylpentyl]-1-[(2,3-dichlorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 161218680 |
| Molecular Formula | C34H33Cl2F3N6OS |
| Molecular Weight | 701.65 g/mol |
| Exact Mass | 700.18 |
| IUPAC Name | 1-[(2S,3S)-1-amino-2-[2-[3-[(4-cyanophenyl)methyl]imidazol-4-yl]acetyl]-3-methylpentyl]-1-[(2,3-dichlorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC[C@H](C)[C@H](C(=O)Cc1cncn1Cc1ccc(C#N)cc1)C(N)N(Cc1cccc(Cl)c1Cl)C(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H33Cl2F3N6OS/c1-3-21(2)30(29(46)15-27-17-42-20-44(27)18-23-12-10-22(16-40)11-13-23)32(41)45(19-24-6-4-9-28(35)31(24)36)33(47)43-26-8-5-7-25(14-26)34(37,38)39/h4-14,17,20-21,30,32H,3,15,18-19,41H2,1-2H3,(H,43,47)/t21-,30+,32?/m0/s1 |
| InChIKey | UXFFOJPTTIEAPK-MPIARECVSA-N |
| XLogP | 8.09 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.65 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|