C24H33N4OS+ — CID 5049329
diethyl-[3-[1H-indol-3-ylmethyl-[(4-methoxyphenyl)carbamothioyl]amino]propyl]azanium (PubChem CID 5049329) has the molecular formula C24H33N4OS+ and a molecular weight of 425.62 g/mol. Its IUPAC name is diethyl-[3-[1H-indol-3-ylmethyl-[(4-methoxyphenyl)carbamothioyl]amino]propyl]azanium.
| Compound Name | diethyl-[3-[1H-indol-3-ylmethyl-[(4-methoxyphenyl)carbamothioyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 5049329 |
| Molecular Formula | C24H33N4OS+ |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | diethyl-[3-[1H-indol-3-ylmethyl-[(4-methoxyphenyl)carbamothioyl]amino]propyl]azanium |
| SMILES | CC[NH+](CC)CCCN(Cc1c[nH]c2ccccc12)C(=S)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H32N4OS/c1-4-27(5-2)15-8-16-28(18-19-17-25-23-10-7-6-9-22(19)23)24(30)26-20-11-13-21(29-3)14-12-20/h6-7,9-14,17,25H,4-5,8,15-16,18H2,1-3H3,(H,26,30)/p+1 |
| InChIKey | COURPEGVOOISHZ-UHFFFAOYSA-O |
| XLogP | 3.69 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|