C24H24N4OS — CID 3869629
1-[2-(1H-benzimidazol-2-yl)ethyl]-1-benzyl-3-(4-methoxyphenyl)thiourea (PubChem CID 3869629) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-1-benzyl-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-1-benzyl-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3869629 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-1-benzyl-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(CCc2nc3ccccc3[nH]2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N4OS/c1-29-20-13-11-19(12-14-20)25-24(30)28(17-18-7-3-2-4-8-18)16-15-23-26-21-9-5-6-10-22(21)27-23/h2-14H,15-17H2,1H3,(H,25,30)(H,26,27) |
| InChIKey | GITAELKQNXFQKB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|