C25H25FN4O2 — CID 1454622
1-[2-(1H-benzimidazol-2-yl)ethyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]urea (PubChem CID 1454622) has the molecular formula C25H25FN4O2 and a molecular weight of 432.50 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 1454622 |
| Molecular Formula | C25H25FN4O2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]urea |
| SMILES | CCOc1ccc(NC(=O)N(CCc2nc3ccccc3[nH]2)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H25FN4O2/c1-2-32-21-13-11-20(12-14-21)27-25(31)30(17-18-7-9-19(26)10-8-18)16-15-24-28-22-5-3-4-6-23(22)29-24/h3-14H,2,15-17H2,1H3,(H,27,31)(H,28,29) |
| InChIKey | IIMYQYHJARXVQF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |