C25H24N4O2 — CID 1454656
3-(3-acetylphenyl)-1-[2-(1H-benzimidazol-2-yl)ethyl]-1-benzylurea (PubChem CID 1454656) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-(3-acetylphenyl)-1-[2-(1H-benzimidazol-2-yl)ethyl]-1-benzylurea.
| Compound Name | 3-(3-acetylphenyl)-1-[2-(1H-benzimidazol-2-yl)ethyl]-1-benzylurea |
|---|---|
| PubChem CID | 1454656 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-(3-acetylphenyl)-1-[2-(1H-benzimidazol-2-yl)ethyl]-1-benzylurea |
| SMILES | CC(=O)c1cccc(NC(=O)N(CCc2nc3ccccc3[nH]2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H24N4O2/c1-18(30)20-10-7-11-21(16-20)26-25(31)29(17-19-8-3-2-4-9-19)15-14-24-27-22-12-5-6-13-23(22)28-24/h2-13,16H,14-15,17H2,1H3,(H,26,31)(H,27,28) |
| InChIKey | KUJGUNHBIYNEJY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |