C20H23FN4S — CID 45076351
3-[2-(1H-benzimidazol-2-yl)ethyl]-1-[(4-fluorophenyl)methyl]-1-propylthiourea (PubChem CID 45076351) has the molecular formula C20H23FN4S and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-[2-(1H-benzimidazol-2-yl)ethyl]-1-[(4-fluorophenyl)methyl]-1-propylthiourea.
| Compound Name | 3-[2-(1H-benzimidazol-2-yl)ethyl]-1-[(4-fluorophenyl)methyl]-1-propylthiourea |
|---|---|
| PubChem CID | 45076351 |
| Molecular Formula | C20H23FN4S |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[2-(1H-benzimidazol-2-yl)ethyl]-1-[(4-fluorophenyl)methyl]-1-propylthiourea |
| SMILES | CCCN(Cc1ccc(F)cc1)C(=S)NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H23FN4S/c1-2-13-25(14-15-7-9-16(21)10-8-15)20(26)22-12-11-19-23-17-5-3-4-6-18(17)24-19/h3-10H,2,11-14H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | GLUCXQRODBPRAS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|