C21H27FIN5 — CID 111307259
2-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111307259) has the molecular formula C21H27FIN5 and a molecular weight of 495.38 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111307259 |
| Molecular Formula | C21H27FIN5 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc2ccccc2[nH]1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C21H26FN5.HI/c1-3-23-21(27(2)15-16-10-12-17(22)13-11-16)24-14-6-9-20-25-18-7-4-5-8-19(18)26-20;/h4-5,7-8,10-13H,3,6,9,14-15H2,1-2H3,(H,23,24)(H,25,26);1H |
| InChIKey | RIZBCXDTWMFGBC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|