C21H28IN5 — CID 111289136
2-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-1-methyl-1-[(4-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111289136) has the molecular formula C21H28IN5 and a molecular weight of 477.39 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-1-methyl-1-[(4-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-1-methyl-1-[(4-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111289136 |
| Molecular Formula | C21H28IN5 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)ethyl]-3-ethyl-1-methyl-1-[(4-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc2ccccc2[nH]1)N(C)Cc1ccc(C)cc1.I |
| InChI | InChI=1S/C21H27N5.HI/c1-4-22-21(26(3)15-17-11-9-16(2)10-12-17)23-14-13-20-24-18-7-5-6-8-19(18)25-20;/h5-12H,4,13-15H2,1-3H3,(H,22,23)(H,24,25);1H |
| InChIKey | UAGAKDXQRSCBBF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|