C24H25N5S — CID 1454772
1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-3-phenyl-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 1454772) has the molecular formula C24H25N5S and a molecular weight of 415.57 g/mol. Its IUPAC name is 1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-3-phenyl-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-3-phenyl-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1454772 |
| Molecular Formula | C24H25N5S |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-3-phenyl-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1cc2nc(CCN(Cc3cccnc3)C(=S)Nc3ccccc3)[nH]c2cc1C |
| InChI | InChI=1S/C24H25N5S/c1-17-13-21-22(14-18(17)2)28-23(27-21)10-12-29(16-19-7-6-11-25-15-19)24(30)26-20-8-4-3-5-9-20/h3-9,11,13-15H,10,12,16H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | ANPNRLKOCVJDFZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|