About 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea
3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea (PubChem CID 3615223) has the molecular formula C24H31N5O
and a molecular weight of 405.55 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea |
| PubChem CID | 3615223 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea |
| SMILES | Cc1cc2nc(CCN(Cc3cccnc3)C(=O)NC3CCCCC3)[nH]c2cc1C |
| InChI | InChI=1S/C24H31N5O/c1-17-13-21-22(14-18(17)2)28-23(27-21)10-12-29(16-19-7-6-11-25-15-19)24(30)26-20-8-4-3-5-9-20/h6-7,11,13-15,20H,3-5,8-10,12,16H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | VIGUWLWFWWUWIS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea?
The IUPAC name of 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea (CID 3615223) is 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea.
What is the SMILES notation for 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea?
The canonical SMILES for 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea is Cc1cc2nc(CCN(Cc3cccnc3)C(=O)NC3CCCCC3)[nH]c2cc1C.
What is the InChIKey of 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea?
The InChIKey is VIGUWLWFWWUWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N5O/c1-17-13-21-22(14-18(17)2)28-23(27-21)10-12-29(16-19-7-6-11-25-15-19)24(30)26-20-8-4-3-5-9-20/h6-7,11,13-15,20H,3-5,8-10,12,16H2,1-2H3,(H,26,30)(H,27,28).
What are the key properties of 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea?
3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea has a molecular weight of 405.55 g/mol, XLogP of 4.66, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-1-(pyridin-3-ylmethyl)urea is sourced from PubChem (CID 3615223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).