C26H29N3O2 — CID 42700935
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[2-(1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)urea (PubChem CID 42700935) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[2-(1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[2-(1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 42700935 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1-[2-(1H-indol-3-yl)ethyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(CCc2c[nH]c3ccccc23)CC2CC3C=CC2C3)cc1 |
| InChI | InChI=1S/C26H29N3O2/c1-31-23-10-8-22(9-11-23)28-26(30)29(17-21-15-18-6-7-19(21)14-18)13-12-20-16-27-25-5-3-2-4-24(20)25/h2-11,16,18-19,21,27H,12-15,17H2,1H3,(H,28,30) |
| InChIKey | WPSAPMUQEOGEDS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|