C12H12N2O2 — CID 45097499
1-(1,3-benzodioxol-5-ylmethyl)-2-methylimidazole (PubChem CID 45097499) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methylimidazole.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methylimidazole |
|---|---|
| PubChem CID | 45097499 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methylimidazole |
| SMILES | Cc1nccn1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H12N2O2/c1-9-13-4-5-14(9)7-10-2-3-11-12(6-10)16-8-15-11/h2-6H,7-8H2,1H3 |
| InChIKey | LCHTVPSKRIQRRC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |