C17H21NO3 — CID 79109962
1-[1-[(3,4-dimethoxyphenyl)methyl]pyrrol-3-yl]butan-1-one (PubChem CID 79109962) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-[1-[(3,4-dimethoxyphenyl)methyl]pyrrol-3-yl]butan-1-one.
| Compound Name | 1-[1-[(3,4-dimethoxyphenyl)methyl]pyrrol-3-yl]butan-1-one |
|---|---|
| PubChem CID | 79109962 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-[1-[(3,4-dimethoxyphenyl)methyl]pyrrol-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1ccn(Cc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C17H21NO3/c1-4-5-15(19)14-8-9-18(12-14)11-13-6-7-16(20-2)17(10-13)21-3/h6-10,12H,4-5,11H2,1-3H3 |
| InChIKey | AUHRHRGVVAJKTN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |