C12H14N4O2S — CID 62950166
1-[(3,4-dimethoxyphenyl)methyl]-1,2,4-triazole-3-carbothioamide (PubChem CID 62950166) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 62950166 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-1,2,4-triazole-3-carbothioamide |
| SMILES | COc1ccc(Cn2cnc(C(N)=S)n2)cc1OC |
| InChI | InChI=1S/C12H14N4O2S/c1-17-9-4-3-8(5-10(9)18-2)6-16-7-14-12(15-16)11(13)19/h3-5,7H,6H2,1-2H3,(H2,13,19) |
| InChIKey | JTLWEYGEHAZZMP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|