C10H11N5S — CID 102878770
1-[(5-methyl-3-pyridinyl)methyl]-1,2,4-triazole-3-carbothioamide (PubChem CID 102878770) has the molecular formula C10H11N5S and a molecular weight of 233.30 g/mol. Its IUPAC name is 1-[(5-methyl-3-pyridinyl)methyl]-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-[(5-methyl-3-pyridinyl)methyl]-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 102878770 |
| Molecular Formula | C10H11N5S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1-[(5-methyl-3-pyridinyl)methyl]-1,2,4-triazole-3-carbothioamide |
| SMILES | Cc1cncc(Cn2cnc(C(N)=S)n2)c1 |
| InChI | InChI=1S/C10H11N5S/c1-7-2-8(4-12-3-7)5-15-6-13-10(14-15)9(11)16/h2-4,6H,5H2,1H3,(H2,11,16) |
| InChIKey | JQZZVVBCAYQQFY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|