C8H8N4S2 — CID 62949436
1-(thiophen-3-ylmethyl)-1,2,4-triazole-3-carbothioamide (PubChem CID 62949436) has the molecular formula C8H8N4S2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-(thiophen-3-ylmethyl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(thiophen-3-ylmethyl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 62949436 |
| Molecular Formula | C8H8N4S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 1-(thiophen-3-ylmethyl)-1,2,4-triazole-3-carbothioamide |
| SMILES | NC(=S)c1ncn(Cc2ccsc2)n1 |
| InChI | InChI=1S/C8H8N4S2/c9-7(13)8-10-5-12(11-8)3-6-1-2-14-4-6/h1-2,4-5H,3H2,(H2,9,13) |
| InChIKey | SWKSUZZHUBVPAB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|