C14H12N4S — CID 55153724
1-(naphthalen-1-ylmethyl)-1,2,4-triazole-3-carbothioamide (PubChem CID 55153724) has the molecular formula C14H12N4S and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(naphthalen-1-ylmethyl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(naphthalen-1-ylmethyl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 55153724 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-(naphthalen-1-ylmethyl)-1,2,4-triazole-3-carbothioamide |
| SMILES | NC(=S)c1ncn(Cc2cccc3ccccc23)n1 |
| InChI | InChI=1S/C14H12N4S/c15-13(19)14-16-9-18(17-14)8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,9H,8H2,(H2,15,19) |
| InChIKey | HJKMTJQYOIIWTQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|