C16H15N3O2 — CID 122171697
methyl 3-amino-1-(naphthalen-1-ylmethyl)pyrazole-4-carboxylate (PubChem CID 122171697) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is methyl 3-amino-1-(naphthalen-1-ylmethyl)pyrazole-4-carboxylate.
| Compound Name | methyl 3-amino-1-(naphthalen-1-ylmethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 122171697 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | methyl 3-amino-1-(naphthalen-1-ylmethyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cn(Cc2cccc3ccccc23)nc1N |
| InChI | InChI=1S/C16H15N3O2/c1-21-16(20)14-10-19(18-15(14)17)9-12-7-4-6-11-5-2-3-8-13(11)12/h2-8,10H,9H2,1H3,(H2,17,18) |
| InChIKey | PTFBJCXMXWQKTG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |