C12H16N4S2 — CID 63758073
1,3-dimethyl-5-[methyl(thiophen-3-ylmethyl)amino]pyrazole-4-carbothioamide (PubChem CID 63758073) has the molecular formula C12H16N4S2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 1,3-dimethyl-5-[methyl(thiophen-3-ylmethyl)amino]pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-[methyl(thiophen-3-ylmethyl)amino]pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63758073 |
| Molecular Formula | C12H16N4S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1,3-dimethyl-5-[methyl(thiophen-3-ylmethyl)amino]pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(N(C)Cc2ccsc2)c1C(N)=S |
| InChI | InChI=1S/C12H16N4S2/c1-8-10(11(13)17)12(16(3)14-8)15(2)6-9-4-5-18-7-9/h4-5,7H,6H2,1-3H3,(H2,13,17) |
| InChIKey | HLYYUFZIEKVCSY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|