C13H18N4S2 — CID 79493990
1,3-dimethyl-5-[methyl(2-thiophen-2-ylethyl)amino]pyrazole-4-carbothioamide (PubChem CID 79493990) has the molecular formula C13H18N4S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 1,3-dimethyl-5-[methyl(2-thiophen-2-ylethyl)amino]pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-[methyl(2-thiophen-2-ylethyl)amino]pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 79493990 |
| Molecular Formula | C13H18N4S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1,3-dimethyl-5-[methyl(2-thiophen-2-ylethyl)amino]pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(N(C)CCc2cccs2)c1C(N)=S |
| InChI | InChI=1S/C13H18N4S2/c1-9-11(12(14)18)13(17(3)15-9)16(2)7-6-10-5-4-8-19-10/h4-5,8H,6-7H2,1-3H3,(H2,14,18) |
| InChIKey | DPDKKSGDGJYGIX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|