C10H16N2S2 — CID 63775676
2-[ethyl(2-thiophen-2-ylethyl)amino]ethanethioamide (PubChem CID 63775676) has the molecular formula C10H16N2S2 and a molecular weight of 228.39 g/mol. Its IUPAC name is 2-[ethyl(2-thiophen-2-ylethyl)amino]ethanethioamide.
| Compound Name | 2-[ethyl(2-thiophen-2-ylethyl)amino]ethanethioamide |
|---|---|
| PubChem CID | 63775676 |
| Molecular Formula | C10H16N2S2 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-[ethyl(2-thiophen-2-ylethyl)amino]ethanethioamide |
| SMILES | CCN(CCc1cccs1)CC(N)=S |
| InChI | InChI=1S/C10H16N2S2/c1-2-12(8-10(11)13)6-5-9-4-3-7-14-9/h3-4,7H,2,5-6,8H2,1H3,(H2,11,13) |
| InChIKey | NCFDMTKLPMDNPM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|