C14H20ClN3S — CID 75509584
5-[[ethyl(2-thiophen-2-ylethyl)amino]methyl]pyridin-2-amine;hydrochloride (PubChem CID 75509584) has the molecular formula C14H20ClN3S and a molecular weight of 297.86 g/mol. Its IUPAC name is 5-[[ethyl(2-thiophen-2-ylethyl)amino]methyl]pyridin-2-amine;hydrochloride.
| Compound Name | 5-[[ethyl(2-thiophen-2-ylethyl)amino]methyl]pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 75509584 |
| Molecular Formula | C14H20ClN3S |
| Molecular Weight | 297.86 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 5-[[ethyl(2-thiophen-2-ylethyl)amino]methyl]pyridin-2-amine;hydrochloride |
| SMILES | CCN(CCc1cccs1)Cc1ccc(N)nc1.Cl |
| InChI | InChI=1S/C14H19N3S.ClH/c1-2-17(8-7-13-4-3-9-18-13)11-12-5-6-14(15)16-10-12;/h3-6,9-10H,2,7-8,11H2,1H3,(H2,15,16);1H |
| InChIKey | UBOHXEAGZQAKOQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.86 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |