C13H24N2S — CID 81079435
N',2-diethyl-N'-(thiophen-2-ylmethyl)butane-1,4-diamine (PubChem CID 81079435) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is N',2-diethyl-N'-(thiophen-2-ylmethyl)butane-1,4-diamine.
| Compound Name | N',2-diethyl-N'-(thiophen-2-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 81079435 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | N',2-diethyl-N'-(thiophen-2-ylmethyl)butane-1,4-diamine |
| SMILES | CCC(CN)CCN(CC)Cc1cccs1 |
| InChI | InChI=1S/C13H24N2S/c1-3-12(10-14)7-8-15(4-2)11-13-6-5-9-16-13/h5-6,9,12H,3-4,7-8,10-11,14H2,1-2H3 |
| InChIKey | HIHMKJMFUOVCNH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |