C10H17NS — CID 63774088
2-ethyl-4-thiophen-2-ylbutan-1-amine (PubChem CID 63774088) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is 2-ethyl-4-thiophen-2-ylbutan-1-amine.
| Compound Name | 2-ethyl-4-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 63774088 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-ethyl-4-thiophen-2-ylbutan-1-amine |
| SMILES | CCC(CN)CCc1cccs1 |
| InChI | InChI=1S/C10H17NS/c1-2-9(8-11)5-6-10-4-3-7-12-10/h3-4,7,9H,2,5-6,8,11H2,1H3 |
| InChIKey | VKYJIUMZIDOVHR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |