C12H15N3S — CID 80652044
6-N-methyl-6-N-(2-thiophen-2-ylethyl)pyridine-2,6-diamine (PubChem CID 80652044) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 6-N-methyl-6-N-(2-thiophen-2-ylethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-methyl-6-N-(2-thiophen-2-ylethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80652044 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 6-N-methyl-6-N-(2-thiophen-2-ylethyl)pyridine-2,6-diamine |
| SMILES | CN(CCc1cccs1)c1cccc(N)n1 |
| InChI | InChI=1S/C12H15N3S/c1-15(8-7-10-4-3-9-16-10)12-6-2-5-11(13)14-12/h2-6,9H,7-8H2,1H3,(H2,13,14) |
| InChIKey | HMONSNHGJXDXTC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |