C9H9N5S — CID 62949800
1-(pyridin-3-ylmethyl)-1,2,4-triazole-3-carbothioamide (PubChem CID 62949800) has the molecular formula C9H9N5S and a molecular weight of 219.27 g/mol. Its IUPAC name is 1-(pyridin-3-ylmethyl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(pyridin-3-ylmethyl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 62949800 |
| Molecular Formula | C9H9N5S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 1-(pyridin-3-ylmethyl)-1,2,4-triazole-3-carbothioamide |
| SMILES | NC(=S)c1ncn(Cc2cccnc2)n1 |
| InChI | InChI=1S/C9H9N5S/c10-8(15)9-12-6-14(13-9)5-7-2-1-3-11-4-7/h1-4,6H,5H2,(H2,10,15) |
| InChIKey | XCJMYUCYPRDWBN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|