C11H9F3N4OS — CID 62949802
1-[[4-(trifluoromethoxy)phenyl]methyl]-1,2,4-triazole-3-carbothioamide (PubChem CID 62949802) has the molecular formula C11H9F3N4OS and a molecular weight of 302.28 g/mol. Its IUPAC name is 1-[[4-(trifluoromethoxy)phenyl]methyl]-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-[[4-(trifluoromethoxy)phenyl]methyl]-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 62949802 |
| Molecular Formula | C11H9F3N4OS |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-[[4-(trifluoromethoxy)phenyl]methyl]-1,2,4-triazole-3-carbothioamide |
| SMILES | NC(=S)c1ncn(Cc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C11H9F3N4OS/c12-11(13,14)19-8-3-1-7(2-4-8)5-18-6-16-10(17-18)9(15)20/h1-4,6H,5H2,(H2,15,20) |
| InChIKey | GKJQCFJGNSQHQR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|