C15H23N4O2S+ — CID 9240724
(3,4-dimethoxyphenyl)methyl-[(4-ethyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]-methylazanium (PubChem CID 9240724) has the molecular formula C15H23N4O2S+ and a molecular weight of 323.44 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-[(4-ethyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]-methylazanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-[(4-ethyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9240724 |
| Molecular Formula | C15H23N4O2S+ |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-[(4-ethyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]-methylazanium |
| SMILES | CCn1cnn(C[NH+](C)Cc2ccc(OC)c(OC)c2)c1=S |
| InChI | InChI=1S/C15H22N4O2S/c1-5-18-10-16-19(15(18)22)11-17(2)9-12-6-7-13(20-3)14(8-12)21-4/h6-8,10H,5,9,11H2,1-4H3/p+1 |
| InChIKey | LHYVQJRIDQGFFI-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|