C22H25N2O3+ — CID 9323567
(2-hydroxy-7-methoxynaphthalen-1-yl)methyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium (PubChem CID 9323567) has the molecular formula C22H25N2O3+ and a molecular weight of 365.45 g/mol. Its IUPAC name is (2-hydroxy-7-methoxynaphthalen-1-yl)methyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium.
| Compound Name | (2-hydroxy-7-methoxynaphthalen-1-yl)methyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9323567 |
| Molecular Formula | C22H25N2O3+ |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (2-hydroxy-7-methoxynaphthalen-1-yl)methyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
| SMILES | CNC(=O)c1ccc(C[NH+](C)Cc2c(O)ccc3ccc(OC)cc23)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-23-22(26)17-6-4-15(5-7-17)13-24(2)14-20-19-12-18(27-3)10-8-16(19)9-11-21(20)25/h4-12,25H,13-14H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | ZWUGGGLFFCDSNN-UHFFFAOYSA-O |
| XLogP | 2.13 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|