C21H29N2O2+ — CID 9125584
3-(2,5-dimethylphenoxy)propyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium (PubChem CID 9125584) has the molecular formula C21H29N2O2+ and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-(2,5-dimethylphenoxy)propyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium.
| Compound Name | 3-(2,5-dimethylphenoxy)propyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9125584 |
| Molecular Formula | C21H29N2O2+ |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 3-(2,5-dimethylphenoxy)propyl-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
| SMILES | CNC(=O)c1ccc(C[NH+](C)CCCOc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-16-6-7-17(2)20(14-16)25-13-5-12-23(4)15-18-8-10-19(11-9-18)21(24)22-3/h6-11,14H,5,12-13,15H2,1-4H3,(H,22,24)/p+1 |
| InChIKey | OTTVCMDBQDRUCX-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|