C23H27N3OS — CID 18292330
1-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-3-(2,5-dimethylphenyl)imidazole-2-thione (PubChem CID 18292330) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is 1-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-3-(2,5-dimethylphenyl)imidazole-2-thione.
| Compound Name | 1-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-3-(2,5-dimethylphenyl)imidazole-2-thione |
|---|---|
| PubChem CID | 18292330 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[[cyclopropyl-[(4-methoxyphenyl)methyl]amino]methyl]-3-(2,5-dimethylphenyl)imidazole-2-thione |
| SMILES | COc1ccc(CN(Cn2ccn(-c3cc(C)ccc3C)c2=S)C2CC2)cc1 |
| InChI | InChI=1S/C23H27N3OS/c1-17-4-5-18(2)22(14-17)26-13-12-24(23(26)28)16-25(20-8-9-20)15-19-6-10-21(27-3)11-7-19/h4-7,10-14,20H,8-9,15-16H2,1-3H3 |
| InChIKey | CTPFFLPNVXMHSR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 22.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|