C19H20N4O3 — CID 31385919
N-[(4-methoxyphenyl)methyl]-N-[(5-nitroindazol-1-yl)methyl]cyclopropanamine (PubChem CID 31385919) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N-[(5-nitroindazol-1-yl)methyl]cyclopropanamine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N-[(5-nitroindazol-1-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 31385919 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N-[(5-nitroindazol-1-yl)methyl]cyclopropanamine |
| SMILES | COc1ccc(CN(Cn2ncc3cc([N+](=O)[O-])ccc32)C2CC2)cc1 |
| InChI | InChI=1S/C19H20N4O3/c1-26-18-7-2-14(3-8-18)12-21(16-4-5-16)13-22-19-9-6-17(23(24)25)10-15(19)11-20-22/h2-3,6-11,16H,4-5,12-13H2,1H3 |
| InChIKey | BRMVCDVBMLWQIO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|