C16H21N5O4 — CID 47060658
2-methoxy-N-[1-[(5-nitroindazol-1-yl)methyl]piperidin-4-yl]acetamide (PubChem CID 47060658) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-methoxy-N-[1-[(5-nitroindazol-1-yl)methyl]piperidin-4-yl]acetamide.
| Compound Name | 2-methoxy-N-[1-[(5-nitroindazol-1-yl)methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 47060658 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-methoxy-N-[1-[(5-nitroindazol-1-yl)methyl]piperidin-4-yl]acetamide |
| SMILES | COCC(=O)NC1CCN(Cn2ncc3cc([N+](=O)[O-])ccc32)CC1 |
| InChI | InChI=1S/C16H21N5O4/c1-25-10-16(22)18-13-4-6-19(7-5-13)11-20-15-3-2-14(21(23)24)8-12(15)9-17-20/h2-3,8-9,13H,4-7,10-11H2,1H3,(H,18,22) |
| InChIKey | IAKKOPMLQCEMQK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|