C16H20N4O4 — CID 29427718
ethyl 1-[(5-nitroindazol-1-yl)methyl]piperidine-4-carboxylate (PubChem CID 29427718) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 1-[(5-nitroindazol-1-yl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(5-nitroindazol-1-yl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 29427718 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | ethyl 1-[(5-nitroindazol-1-yl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cn2ncc3cc([N+](=O)[O-])ccc32)CC1 |
| InChI | InChI=1S/C16H20N4O4/c1-2-24-16(21)12-5-7-18(8-6-12)11-19-15-4-3-14(20(22)23)9-13(15)10-17-19/h3-4,9-10,12H,2,5-8,11H2,1H3 |
| InChIKey | NRAUVILVQDUICP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|