C17H21N5O4 — CID 36694446
ethyl 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperidine-4-carboxylate (PubChem CID 36694446) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is ethyl 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 36694446 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | ethyl 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cn2cnc(-c3ccc([N+](=O)[O-])cc3)n2)CC1 |
| InChI | InChI=1S/C17H21N5O4/c1-2-26-17(23)14-7-9-20(10-8-14)12-21-11-18-16(19-21)13-3-5-15(6-4-13)22(24)25/h3-6,11,14H,2,7-10,12H2,1H3 |
| InChIKey | BPHFISNEAJSPMQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|