C18H22N2O7S — CID 7132262
ethyl 1-[2-[2-(4-nitrophenyl)sulfanylacetyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 7132262) has the molecular formula C18H22N2O7S and a molecular weight of 410.45 g/mol. Its IUPAC name is ethyl 1-[2-[2-(4-nitrophenyl)sulfanylacetyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-(4-nitrophenyl)sulfanylacetyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7132262 |
| Molecular Formula | C18H22N2O7S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | ethyl 1-[2-[2-(4-nitrophenyl)sulfanylacetyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)CSc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C18H22N2O7S/c1-2-26-18(23)13-7-9-19(10-8-13)16(21)11-27-17(22)12-28-15-5-3-14(4-6-15)20(24)25/h3-6,13H,2,7-12H2,1H3 |
| InChIKey | HCACHCKSMGKWLA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|