C19H21N3OS2 — CID 9244705
1-(4-methoxyphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazole-2-thione (PubChem CID 9244705) has the molecular formula C19H21N3OS2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazole-2-thione.
| Compound Name | 1-(4-methoxyphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazole-2-thione |
|---|---|
| PubChem CID | 9244705 |
| Molecular Formula | C19H21N3OS2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazole-2-thione |
| SMILES | COc1ccc(-n2ccn(CN3CCC[C@H]3c3cccs3)c2=S)cc1 |
| InChI | InChI=1S/C19H21N3OS2/c1-23-16-8-6-15(7-9-16)22-12-11-21(19(22)24)14-20-10-2-4-17(20)18-5-3-13-25-18/h3,5-9,11-13,17H,2,4,10,14H2,1H3/t17-/m0/s1 |
| InChIKey | BTFNAHIFAGBJCQ-KRWDZBQOSA-N |
| XLogP | 4.87 |
| TPSA | 22.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|