C20H22ClN5S — CID 24563755
5-(4-chlorophenyl)-4-ethyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 24563755) has the molecular formula C20H22ClN5S and a molecular weight of 399.95 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-ethyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-chlorophenyl)-4-ethyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24563755 |
| Molecular Formula | C20H22ClN5S |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 5-(4-chlorophenyl)-4-ethyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccc(Cl)cc2)nn(CN2CCCC2c2cccnc2)c1=S |
| InChI | InChI=1S/C20H22ClN5S/c1-2-25-19(15-7-9-17(21)10-8-15)23-26(20(25)27)14-24-12-4-6-18(24)16-5-3-11-22-13-16/h3,5,7-11,13,18H,2,4,6,12,14H2,1H3 |
| InChIKey | NLJOTYWGZQRZEV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|