C18H17N5S2 — CID 24563715
2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione (PubChem CID 24563715) has the molecular formula C18H17N5S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione.
| Compound Name | 2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
|---|---|
| PubChem CID | 24563715 |
| Molecular Formula | C18H17N5S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-[1,2,4]triazolo[3,4-b][1,3]benzothiazole-1-thione |
| SMILES | S=c1n(CN2CCCC2c2cccnc2)nc2sc3ccccc3n12 |
| InChI | InChI=1S/C18H17N5S2/c24-18-22(20-17-23(18)15-6-1-2-8-16(15)25-17)12-21-10-4-7-14(21)13-5-3-9-19-11-13/h1-3,5-6,8-9,11,14H,4,7,10,12H2 |
| InChIKey | HTEWRUFTHVLUKJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|