C26H24N6S2 — CID 24505413
2-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione (PubChem CID 24505413) has the molecular formula C26H24N6S2 and a molecular weight of 484.65 g/mol. Its IUPAC name is 2-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24505413 |
| Molecular Formula | C26H24N6S2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-phenyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCCCC2c2nc3ccccc3s2)nc(-c2cccnc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H24N6S2/c33-26-31(29-24(19-9-8-15-27-17-19)32(26)20-10-2-1-3-11-20)18-30-16-7-6-13-22(30)25-28-21-12-4-5-14-23(21)34-25/h1-5,8-12,14-15,17,22H,6-7,13,16,18H2 |
| InChIKey | MJTVCKBLKMVZEO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|