C23H29N5S2 — CID 24563721
4-cyclohexyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 24563721) has the molecular formula C23H29N5S2 and a molecular weight of 439.65 g/mol. Its IUPAC name is 4-cyclohexyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclohexyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24563721 |
| Molecular Formula | C23H29N5S2 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-cyclohexyl-2-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCCC2c2cccnc2)nc(Cc2cccs2)n1C1CCCCC1 |
| InChI | InChI=1S/C23H29N5S2/c29-23-27(17-26-13-5-11-21(26)18-7-4-12-24-16-18)25-22(15-20-10-6-14-30-20)28(23)19-8-2-1-3-9-19/h4,6-7,10,12,14,16,19,21H,1-3,5,8-9,11,13,15,17H2 |
| InChIKey | OFYTYWDWUHFBHY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|